CAS 1246018-36-9 is the registry number for ST4206. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[6-amino-9-methyl-8-(triazol-2-yl)purin-2-yl]butan-2-one (CAS 1246018-36-9) is a chemical compound with the molecular formula C12H14N8O and a molecular weight of 286.29 g/mol. IUPAC name: 4-[6-amino-9-methyl-8-(triazol-2-yl)purin-2-yl]butan-2-one. InChIKey: PLXYHOBIHWLDSZ-UHFFFAOYSA-N.
| Molecular formula | C12H14N8O |
|---|---|
| Molecular weight | 286.29 g/mol |
| IUPAC name | 4-[6-amino-9-methyl-8-(triazol-2-yl)purin-2-yl]butan-2-one |
| InChIKey | PLXYHOBIHWLDSZ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=NC(=C2C(=N1)N(C(=N2)N3N=CC=N3)C)N |
Computed by PubChem (NCBI)