CAS 1246061-38-0 is the registry number for 3-(2-Chloroethyl)-6-fluoroquinazoline-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2-chloroethyl)-6-fluoro-1H-quinazoline-2,4-dione (CAS 1246061-38-0) is a chemical compound with the molecular formula C10H8ClFN2O2 and a molecular weight of 242.63 g/mol. IUPAC name: 3-(2-chloroethyl)-6-fluoro-1H-quinazoline-2,4-dione. InChIKey: UXVQMHKKDMCOEV-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFN2O2 |
|---|---|
| Molecular weight | 242.63 g/mol |
| IUPAC name | 3-(2-chloroethyl)-6-fluoro-1H-quinazoline-2,4-dione |
| InChIKey | UXVQMHKKDMCOEV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)N(C(=O)N2)CCCl |
Computed by PubChem (NCBI)