CAS 124617-73-8 is the registry number for 3-Benzyl-2-imino-2,3-dihydro-1H-1,3-benzodiazol-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-benzyl-2-iminobenzimidazol-1-amine;hydrochloride (CAS 124617-73-8) is a chemical compound with the molecular formula C14H15ClN4 and a molecular weight of 274.75 g/mol. IUPAC name: 3-benzyl-2-iminobenzimidazol-1-amine;hydrochloride. InChIKey: PDGMOQFQXJIRMB-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN4 |
|---|---|
| Molecular weight | 274.75 g/mol |
| IUPAC name | 3-benzyl-2-iminobenzimidazol-1-amine;hydrochloride |
| InChIKey | PDGMOQFQXJIRMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=CC=CC=C3N(C2=N)N.Cl |
Computed by PubChem (NCBI)