CAS 1246189-43-4 appears in our catalog under these names: Hoocch2ch2o-peg7-ch2ch2cooh, 95%, Bis–PEG8–acid, Bis-PEG8-acid, Bis-PEG8-acid 95%, Bis-PEG8-acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 25g, 50g, 10 g, 5 g.
3-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1246189-43-4) is a chemical compound with the molecular formula C20H38O12 and a molecular weight of 470.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: IRTAMFHIULAGCS-UHFFFAOYSA-N.
| Molecular formula | C20H38O12 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | IRTAMFHIULAGCS-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)