Products 1246213-24-0
CAS 1246213-24-0 appears in our catalog under these names: Ivacaftor Impurity 1, Ivacaftor Carboxylic Acid, >95% (HPLC), Ivacaftor carboxylic acid. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg.
2-[5-tert-butyl-2-hydroxy-4-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl]-2-methylpropanoic acid (CAS 1246213-24-0) is a chemical compound with the molecular formula C24H26N2O5 and a molecular weight of 422.5 g/mol. IUPAC name: 2-[5-tert-butyl-2-hydroxy-4-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl]-2-methylpropanoic acid. InChIKey: JYPYTFLCNPMVBC-UHFFFAOYSA-N.
| Molecular formula | C24H26N2O5 |
|---|---|
| Molecular weight | 422.5 g/mol |
| IUPAC name | 2-[5-tert-butyl-2-hydroxy-4-[(4-oxo-1H-quinoline-3-carbonyl)amino]phenyl]-2-methylpropanoic acid |
| InChIKey | JYPYTFLCNPMVBC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1NC(=O)C2=CNC3=CC=CC=C3C2=O)O)C(C)(C)C(=O)O |
Computed by PubChem (NCBI)