CAS 1246220-99-4 is the registry number for tert-Butyl (R)-(1-hydroxy-3-(2,4,5-trifluorophenyl)propan-2-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2R)-1-hydroxy-3-(2,4,5-trifluorophenyl)propan-2-yl]carbamate (CAS 1246220-99-4) is a chemical compound with the molecular formula C14H18F3NO3 and a molecular weight of 305.29 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-3-(2,4,5-trifluorophenyl)propan-2-yl]carbamate. InChIKey: JIHNFKLLIFSCHO-SECBINFHSA-N.
| Molecular formula | C14H18F3NO3 |
|---|---|
| Molecular weight | 305.29 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-3-(2,4,5-trifluorophenyl)propan-2-yl]carbamate |
| InChIKey | JIHNFKLLIFSCHO-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1F)F)F)CO |
Computed by PubChem (NCBI)