CAS 1246342-65-3 is the registry number for tert–butyl 4–oxopiperidine–1–carboxylate–2,2,3,3,5,5,6,6–d8. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
Tert-butyl 2,2,3,3,5,5,6,6-octadeuterio-4-oxopiperidine-1-carboxylate (CAS 1246342-65-3) is a chemical compound with the molecular formula C10H17NO3 and a molecular weight of 207.30 g/mol. IUPAC name: tert-butyl 2,2,3,3,5,5,6,6-octadeuterio-4-oxopiperidine-1-carboxylate. InChIKey: ROUYFJUVMYHXFJ-DUSUNJSHSA-N.
| Molecular formula | C10H17NO3 |
|---|---|
| Molecular weight | 207.30 g/mol |
| IUPAC name | tert-butyl 2,2,3,3,5,5,6,6-octadeuterio-4-oxopiperidine-1-carboxylate |
| InChIKey | ROUYFJUVMYHXFJ-DUSUNJSHSA-N |
| SMILES | [2H]C1(C(=O)C(C(N(C1([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)