Products 1246384-94-0
CAS 1246384-94-0 is the registry number for 3-(4-Chlorophenyl)-4-fluoro-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-(4-chlorophenyl)-4-fluoro-1H-pyrazol-3-amine (CAS 1246384-94-0) is a chemical compound with the molecular formula C9H7ClFN3 and a molecular weight of 211.62 g/mol. IUPAC name: 5-(4-chlorophenyl)-4-fluoro-1H-pyrazol-3-amine. InChIKey: QZGGUPMSYHHJSN-UHFFFAOYSA-N.
| Molecular formula | C9H7ClFN3 |
|---|---|
| Molecular weight | 211.62 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-4-fluoro-1H-pyrazol-3-amine |
| InChIKey | QZGGUPMSYHHJSN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=NN2)N)F)Cl |
Computed by PubChem (NCBI)