CAS 1246551-70-1 appears in our catalog under these names: Sodium 4-phenyl-1,3-thiazole-2-carboxylate, 95%, Sodium 4-phenyl-1,3-thiazole-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
Sodium 4-phenyl-1,3-thiazole-2-carboxylate (CAS 1246551-70-1) is a chemical compound with the molecular formula C10H6NNaO2S and a molecular weight of 227.22 g/mol. IUPAC name: sodium 4-phenyl-1,3-thiazole-2-carboxylate. InChIKey: FXZHDQMNTCHCHE-UHFFFAOYSA-M.
| Molecular formula | C10H6NNaO2S |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | sodium 4-phenyl-1,3-thiazole-2-carboxylate |
| InChIKey | FXZHDQMNTCHCHE-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)