CAS 1246632-88-1 is the registry number for 3-chloro-2-fluoro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 25g, 1g.
3-chloro-2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1246632-88-1) is a chemical compound with the molecular formula C13H15BClFO3 and a molecular weight of 284.52 g/mol. IUPAC name: 3-chloro-2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: DLIQLWVBIJRKGT-UHFFFAOYSA-N.
| Molecular formula | C13H15BClFO3 |
|---|---|
| Molecular weight | 284.52 g/mol |
| IUPAC name | 3-chloro-2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | DLIQLWVBIJRKGT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)Cl)F)C=O |
Computed by PubChem (NCBI)