Products 1246643-57-1
CAS 1246643-57-1 is the registry number for tert-Butyl 3-amino-6,6-diethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-amino-6,6-diethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate (CAS 1246643-57-1) is a chemical compound with the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. IUPAC name: tert-butyl 3-amino-6,6-diethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate. InChIKey: AZHNHOGJYUYRTD-UHFFFAOYSA-N.
| Molecular formula | C14H24N4O2 |
|---|---|
| Molecular weight | 280.37 g/mol |
| IUPAC name | tert-butyl 3-amino-6,6-diethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxylate |
| InChIKey | AZHNHOGJYUYRTD-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(CN1C(=O)OC(C)(C)C)C(=NN2)N)CC |
Computed by PubChem (NCBI)