Products 124668-48-0
CAS 124668-48-0 is the registry number for N-(Azetidin-3-yl)-2,2,2-trifluoroacetamide hydrochloride, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g.
N-(azetidin-3-yl)-2,2,2-trifluoroacetamide;hydrochloride (CAS 124668-48-0) is a chemical compound with the molecular formula C5H8ClF3N2O and a molecular weight of 204.58 g/mol. IUPAC name: N-(azetidin-3-yl)-2,2,2-trifluoroacetamide;hydrochloride. InChIKey: HVPRNFJOJFQOMZ-UHFFFAOYSA-N.
| Molecular formula | C5H8ClF3N2O |
|---|---|
| Molecular weight | 204.58 g/mol |
| IUPAC name | N-(azetidin-3-yl)-2,2,2-trifluoroacetamide;hydrochloride |
| InChIKey | HVPRNFJOJFQOMZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)NC(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)