CAS 1246759-55-6 is the registry number for Ethyl 7-bromo-1H-1,2,3-benzotriazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
Ethyl 7-bromo-2H-benzotriazole-5-carboxylate (CAS 1246759-55-6) is a chemical compound with the molecular formula C9H8BrN3O2 and a molecular weight of 270.08 g/mol. IUPAC name: ethyl 7-bromo-2H-benzotriazole-5-carboxylate. InChIKey: HJZDKZUAVJDISU-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O2 |
|---|---|
| Molecular weight | 270.08 g/mol |
| IUPAC name | ethyl 7-bromo-2H-benzotriazole-5-carboxylate |
| InChIKey | HJZDKZUAVJDISU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=NNN=C2C(=C1)Br |
Computed by PubChem (NCBI)