Products 1246812-22-5
CAS 1246812-22-5 appears in our catalog under these names: Ramelteon metabolite M–II–d3, Ramelteon Metabolite M-II-d3 (mixture of R and S at the hydroxy position), >95% (HPLC), Ramelteon metabolite M-II-d3, 99.9%. Offered by: GLPBio, TRC, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 1 mg, 5 mg.
3,3,3-trideuterio-2-hydroxy-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide (CAS 1246812-22-5) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 278.36 g/mol. IUPAC name: 3,3,3-trideuterio-2-hydroxy-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide. InChIKey: FGFNIJYHXMJYJN-PJCDIQNWSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 278.36 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-hydroxy-N-[2-[(8S)-2,6,7,8-tetrahydro-1H-cyclopenta[e][1]benzofuran-8-yl]ethyl]propanamide |
| InChIKey | FGFNIJYHXMJYJN-PJCDIQNWSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)NCC[C@@H]1CCC2=C1C3=C(C=C2)OCC3)O |
Computed by PubChem (NCBI)