Products 1246814-62-9
CAS 1246814-62-9 is the registry number for Propamocarb-d6. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 50mg.
Propyl N-[3-[bis(trideuteriomethyl)amino]propyl]carbamate (CAS 1246814-62-9) is a chemical compound with the molecular formula C9H20N2O2 and a molecular weight of 194.30 g/mol. IUPAC name: propyl N-[3-[bis(trideuteriomethyl)amino]propyl]carbamate. InChIKey: WZZLDXDUQPOXNW-XERRXZQWSA-N.
| Molecular formula | C9H20N2O2 |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | propyl N-[3-[bis(trideuteriomethyl)amino]propyl]carbamate |
| InChIKey | WZZLDXDUQPOXNW-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCNC(=O)OCCC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)