CAS 1246815-05-3 appears in our catalog under these names: Dibromo Malonamide-13C3, 2,2-Dibromomalonamide-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2,2-dibromo(1,2,3-13C3)propanediamide (CAS 1246815-05-3) is a chemical compound with the molecular formula C3H4Br2N2O2 and a molecular weight of 262.86 g/mol. IUPAC name: 2,2-dibromo(1,2,3-13C3)propanediamide. InChIKey: SWHQVMGRXIYDSF-VMIGTVKRSA-N.
| Molecular formula | C3H4Br2N2O2 |
|---|---|
| Molecular weight | 262.86 g/mol |
| IUPAC name | 2,2-dibromo(1,2,3-13C3)propanediamide |
| InChIKey | SWHQVMGRXIYDSF-VMIGTVKRSA-N |
| SMILES | [13C](=O)([13C]([13C](=O)N)(Br)Br)N |
Computed by PubChem (NCBI)