CAS 1246815-24-6 is the registry number for 5-Methyl-d3-amino-4-nitro-2,1,3-benzoselenadiazole. Offered by: TRC. Available pack sizes: 250mg, 25mg.
4-nitro-N-(trideuteriomethyl)-2,1,3-benzoselenadiazol-5-amine (CAS 1246815-24-6) is a chemical compound with the molecular formula C7H6N4O2Se and a molecular weight of 260.14 g/mol. IUPAC name: 4-nitro-N-(trideuteriomethyl)-2,1,3-benzoselenadiazol-5-amine. InChIKey: OYZURXRHVHICQN-FIBGUPNXSA-N.
| Molecular formula | C7H6N4O2Se |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 4-nitro-N-(trideuteriomethyl)-2,1,3-benzoselenadiazol-5-amine |
| InChIKey | OYZURXRHVHICQN-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC1=C(C2=N[Se]N=C2C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)