CAS 1246815-27-9 appears in our catalog under these names: 2,5-Deoxyfructosazine-13C4, >95% (HPLC), 2,5-Deoxyfructosazine-13C4. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 25 mg, 1 mg, 5 mg.
(1R,2S,3R)-1-[5-[(2S,3R)-2,3,4-trihydroxybutyl](2,3,5,6-13C4)pyrazin-2-yl]butane-1,2,3,4-tetrol (CAS 1246815-27-9) is a chemical compound with the molecular formula C12H20N2O7 and a molecular weight of 308.27 g/mol. IUPAC name: (1R,2S,3R)-1-[5-[(2S,3R)-2,3,4-trihydroxybutyl](2,3,5,6-13C4)pyrazin-2-yl]butane-1,2,3,4-tetrol. InChIKey: FBDICDJCXVZLIP-ORHSJBJQSA-N.
| Molecular formula | C12H20N2O7 |
|---|---|
| Molecular weight | 308.27 g/mol |
| IUPAC name | (1R,2S,3R)-1-[5-[(2S,3R)-2,3,4-trihydroxybutyl](2,3,5,6-13C4)pyrazin-2-yl]butane-1,2,3,4-tetrol |
| InChIKey | FBDICDJCXVZLIP-ORHSJBJQSA-N |
| SMILES | [13CH]1=[13C](N=[13CH][13C](=N1)[C@H]([C@@H]([C@@H](CO)O)O)O)C[C@@H]([C@@H](CO)O)O |
Computed by PubChem (NCBI)