Products 1246815-34-8
CAS 1246815-34-8 appears in our catalog under these names: 3-(4-Methyl-1H-imidazol-1-yl)-5-trifluoromethylaniline-d3, >95% (HPLC), 3-(4-Methyl-1H-imidazol-1-yl)-5-trifluoromethylaniline-d3. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 25mg.
3-[4-(trideuteriomethyl)imidazol-1-yl]-5-(trifluoromethyl)aniline (CAS 1246815-34-8) is a chemical compound with the molecular formula C11H10F3N3 and a molecular weight of 244.23 g/mol. IUPAC name: 3-[4-(trideuteriomethyl)imidazol-1-yl]-5-(trifluoromethyl)aniline. InChIKey: WWTGXYAJVXKEKL-FIBGUPNXSA-N.
| Molecular formula | C11H10F3N3 |
|---|---|
| Molecular weight | 244.23 g/mol |
| IUPAC name | 3-[4-(trideuteriomethyl)imidazol-1-yl]-5-(trifluoromethyl)aniline |
| InChIKey | WWTGXYAJVXKEKL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CN(C=N1)C2=CC(=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)