CAS 1246815-37-1 is the registry number for Hygrine-d3. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 10mg, 5mg, 25mg.
1,1,1-trideuterio-3-[(2R)-1-methylpyrrolidin-2-yl]propan-2-one (CAS 1246815-37-1) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 144.23 g/mol. IUPAC name: 1,1,1-trideuterio-3-[(2R)-1-methylpyrrolidin-2-yl]propan-2-one. InChIKey: ADKXZIOQKHHDNQ-GTXKLNPESA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 144.23 g/mol |
| IUPAC name | 1,1,1-trideuterio-3-[(2R)-1-methylpyrrolidin-2-yl]propan-2-one |
| InChIKey | ADKXZIOQKHHDNQ-GTXKLNPESA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C[C@H]1CCCN1C |
Computed by PubChem (NCBI)