Products 1246815-37-1

CAS 1246815-37-1 is the registry number for Hygrine-d3. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 10mg, 5mg, 25mg.

Structural formula: {0} (CAS {1})

1,1,1-trideuterio-3-[(2R)-1-methylpyrrolidin-2-yl]propan-2-one (CAS 1246815-37-1) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 144.23 g/mol. IUPAC name: 1,1,1-trideuterio-3-[(2R)-1-methylpyrrolidin-2-yl]propan-2-one. InChIKey: ADKXZIOQKHHDNQ-GTXKLNPESA-N.

Identity
Molecular formulaC8H15NO
Molecular weight144.23 g/mol
IUPAC name1,1,1-trideuterio-3-[(2R)-1-methylpyrrolidin-2-yl]propan-2-one
InChIKeyADKXZIOQKHHDNQ-GTXKLNPESA-N
SMILES[2H]C([2H])([2H])C(=O)C[C@H]1CCCN1C

Computed by PubChem (NCBI)

Synonyms: Hygrine-d3