CAS 1246815-57-5 appears in our catalog under these names: Perazine-d8 Dihydrochloride Salt, >95% (HPLC), Perazine-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
10-[3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propyl]phenothiazine (CAS 1246815-57-5) is a chemical compound with the molecular formula C20H25N3S and a molecular weight of 347.5 g/mol. IUPAC name: 10-[3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propyl]phenothiazine. InChIKey: WEYVCQFUGFRXOM-DBVREXLBSA-N.
| Molecular formula | C20H25N3S |
|---|---|
| Molecular weight | 347.5 g/mol |
| IUPAC name | 10-[3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propyl]phenothiazine |
| InChIKey | WEYVCQFUGFRXOM-DBVREXLBSA-N |
| SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])CCCN2C3=CC=CC=C3SC4=CC=CC=C42)([2H])[2H])[2H] |
Computed by PubChem (NCBI)