CAS 1246815-63-3 appears in our catalog under these names: Nitisinone-13C6, 98% 98%atom%13C, Nitisinone-13C6, >95% (HPLC), Nitisinone-13C6, Nitisinone–13C6. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
2-[2-nitro-4-(trifluoromethyl)benzoyl](1,2,3,4,5,6-13C6)cyclohexane-1,3-dione (CAS 1246815-63-3) is a chemical compound with the molecular formula C14H10F3NO5 and a molecular weight of 335.18 g/mol. IUPAC name: 2-[2-nitro-4-(trifluoromethyl)benzoyl](1,2,3,4,5,6-13C6)cyclohexane-1,3-dione. InChIKey: OUBCNLGXQFSTLU-GRIYWAASSA-N.
| Molecular formula | C14H10F3NO5 |
|---|---|
| Molecular weight | 335.18 g/mol |
| IUPAC name | 2-[2-nitro-4-(trifluoromethyl)benzoyl](1,2,3,4,5,6-13C6)cyclohexane-1,3-dione |
| InChIKey | OUBCNLGXQFSTLU-GRIYWAASSA-N |
| SMILES | [13CH2]1[13CH2][13C](=O)[13CH]([13C](=O)[13CH2]1)C(=O)C2=C(C=C(C=C2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)