CAS 1246815-83-7 appears in our catalog under these names: Pramipexole Impurity 2(Pramipexole EP Impurity B), 2-N-Propyl Pramipexole, 2-N-PROPYL PRAMIPEXOLE, 98%, 98%, Pramipexole impurity 1. Offered by: Hubei YoungXin, TRC, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 250mg, 1g.
(6S)-2-N,6-N-dipropyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 1246815-83-7) is a chemical compound with the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. IUPAC name: (6S)-2-N,6-N-dipropyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: NSHVRDSQVRQBFT-JTQLQIEISA-N.
| Molecular formula | C13H23N3S |
|---|---|
| Molecular weight | 253.41 g/mol |
| IUPAC name | (6S)-2-N,6-N-dipropyl-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | NSHVRDSQVRQBFT-JTQLQIEISA-N |
| SMILES | CCCN[C@H]1CCC2=C(C1)SC(=N2)NCCC |
Computed by PubChem (NCBI)