CAS 1246816-12-5 is the registry number for 4-Amino-1-tert-butyl-3-(3-ethyl)pyrazolo(3,4-d)pyrimidine. Offered by: TRC. Available pack sizes: 100mg.
1-tert-butyl-3-ethylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 1246816-12-5) is a chemical compound with the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. IUPAC name: 1-tert-butyl-3-ethylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: ROXQNWRGRNAAAH-UHFFFAOYSA-N.
| Molecular formula | C11H17N5 |
|---|---|
| Molecular weight | 219.29 g/mol |
| IUPAC name | 1-tert-butyl-3-ethylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | ROXQNWRGRNAAAH-UHFFFAOYSA-N |
| SMILES | CCC1=NN(C2=NC=NC(=C12)N)C(C)(C)C |
Computed by PubChem (NCBI)