Products 1246816-28-3
CAS 1246816-28-3 appears in our catalog under these names: Acipimox-d4, Acipimox-d4, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
3-deuterio-4-oxido-5-(trideuteriomethyl)pyrazin-4-ium-2-carboxylic acid (CAS 1246816-28-3) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 158.15 g/mol. IUPAC name: 3-deuterio-4-oxido-5-(trideuteriomethyl)pyrazin-4-ium-2-carboxylic acid. InChIKey: DJQOOSBJCLSSEY-VYMTUXDUSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | 3-deuterio-4-oxido-5-(trideuteriomethyl)pyrazin-4-ium-2-carboxylic acid |
| InChIKey | DJQOOSBJCLSSEY-VYMTUXDUSA-N |
| SMILES | [2H]C1=[N+](C(=CN=C1C(=O)O)C([2H])([2H])[2H])[O-] |
Computed by PubChem (NCBI)