CAS 1246816-40-9 is the registry number for N-Ethyl-d3 Maleimide. Offered by: TRC. Available pack sizes: 5mg.
1-(2,2,2-trideuterioethyl)pyrrole-2,5-dione (CAS 1246816-40-9) is a chemical compound with the molecular formula C6H7NO2 and a molecular weight of 128.14 g/mol. IUPAC name: 1-(2,2,2-trideuterioethyl)pyrrole-2,5-dione. InChIKey: HDFGOPSGAURCEO-FIBGUPNXSA-N.
| Molecular formula | C6H7NO2 |
|---|---|
| Molecular weight | 128.14 g/mol |
| IUPAC name | 1-(2,2,2-trideuterioethyl)pyrrole-2,5-dione |
| InChIKey | HDFGOPSGAURCEO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)