CAS 1246816-45-4 is the registry number for 5-Aminoimidazole-4-carboxamide-13C2,15N Hydrochloride Salt. Offered by: TRC. Available pack sizes: 0,5mg, 5mg.
4-amino-(4,5-13C2,115N)1H-imidazole-5-carboxamide;hydrochloride (CAS 1246816-45-4) is a chemical compound with the molecular formula C4H7ClN4O and a molecular weight of 165.56 g/mol. IUPAC name: 4-amino-(4,5-13C2,115N)1H-imidazole-5-carboxamide;hydrochloride. InChIKey: MXCUYSMIELHIQL-UJQHOCGYSA-N.
| Molecular formula | C4H7ClN4O |
|---|---|
| Molecular weight | 165.56 g/mol |
| IUPAC name | 4-amino-(4,5-13C2,115N)1H-imidazole-5-carboxamide;hydrochloride |
| InChIKey | MXCUYSMIELHIQL-UJQHOCGYSA-N |
| SMILES | C1=N[13C](=[13C]([15NH]1)C(=O)N)N.Cl |
Computed by PubChem (NCBI)