Products 1246816-50-1
CAS 1246816-50-1 appears in our catalog under these names: R–(–)–Arundic Acid–d3, R-(-)-Arundic acid-d3. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
(2R)-2-(3,3,3-trideuteriopropyl)octanoic acid (CAS 1246816-50-1) is a chemical compound with the molecular formula C11H22O2 and a molecular weight of 189.31 g/mol. IUPAC name: (2R)-2-(3,3,3-trideuteriopropyl)octanoic acid. InChIKey: YCYMCMYLORLIJX-AHTUJLEFSA-N.
| Molecular formula | C11H22O2 |
|---|---|
| Molecular weight | 189.31 g/mol |
| IUPAC name | (2R)-2-(3,3,3-trideuteriopropyl)octanoic acid |
| InChIKey | YCYMCMYLORLIJX-AHTUJLEFSA-N |
| SMILES | [2H]C([2H])([2H])CC[C@H](CCCCCC)C(=O)O |
Computed by PubChem (NCBI)