CAS 1246816-71-6 appears in our catalog under these names: 4-Hydroperoxy Cyclophosphamide-d4, 4–Hydroperoxy Cyclophosphamide–d4, 4-Hydroperoxy Cyclophosphamide-d4, 95.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 100 μg, 1 mg.
N,N-bis(2-chloro-2,2-dideuterioethyl)-4-hydroperoxy-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine (CAS 1246816-71-6) is a chemical compound with the molecular formula C7H15Cl2N2O4P and a molecular weight of 297.11 g/mol. IUPAC name: N,N-bis(2-chloro-2,2-dideuterioethyl)-4-hydroperoxy-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine. InChIKey: VPAWVRUHMJVRHU-RRVWJQJTSA-N.
| Molecular formula | C7H15Cl2N2O4P |
|---|---|
| Molecular weight | 297.11 g/mol |
| IUPAC name | N,N-bis(2-chloro-2,2-dideuterioethyl)-4-hydroperoxy-2-oxo-1,3,2lambda5-oxazaphosphinan-2-amine |
| InChIKey | VPAWVRUHMJVRHU-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(CN(CC([2H])([2H])Cl)P1(=O)NC(CCO1)OO)Cl |
Computed by PubChem (NCBI)