CAS 1246816-83-0 appears in our catalog under these names: 2-Acetamido-5-mercapto-1,3,4-thiadiazole-d3, 2–Acetamido–5–mercapto–1,3,4–thiadiazole–d3. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 10mg.
2,2,2-trideuterio-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)acetamide (CAS 1246816-83-0) is a chemical compound with the molecular formula C4H5N3OS2 and a molecular weight of 178.3 g/mol. IUPAC name: 2,2,2-trideuterio-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)acetamide. InChIKey: DWSMAMSVZRCQMP-FIBGUPNXSA-N.
| Molecular formula | C4H5N3OS2 |
|---|---|
| Molecular weight | 178.3 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)acetamide |
| InChIKey | DWSMAMSVZRCQMP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=NNC(=S)S1 |
Computed by PubChem (NCBI)