Products 1246816-91-0
CAS 1246816-91-0 appears in our catalog under these names: 1-(3,4-Dimethylphenyl)ethanol-13C,d3, 1-(3,4-Dimethylphenyl)ethan-1-ol-13C,d3. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
2,2,2-trideuterio-1-(3,4-dimethylphenyl)(213C)ethanol (CAS 1246816-91-0) is a chemical compound with the molecular formula C10H14O and a molecular weight of 154.23 g/mol. IUPAC name: 2,2,2-trideuterio-1-(3,4-dimethylphenyl)(213C)ethanol. InChIKey: WTTSQZZOTXFJJG-LBDFIVMYSA-N.
| Molecular formula | C10H14O |
|---|---|
| Molecular weight | 154.23 g/mol |
| IUPAC name | 2,2,2-trideuterio-1-(3,4-dimethylphenyl)(213C)ethanol |
| InChIKey | WTTSQZZOTXFJJG-LBDFIVMYSA-N |
| SMILES | [2H][13C]([2H])([2H])C(C1=CC(=C(C=C1)C)C)O |
Computed by PubChem (NCBI)