Products 1246816-93-2
CAS 1246816-93-2 appears in our catalog under these names: Tolcapone-d4, Tolcapone-d4, >95% (HPLC), Tolcapone–d4, Tolcapone-d4, 99.13%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
(3,4-dihydroxy-5-nitrophenyl)-(2,3,5,6-tetradeuterio-4-methylphenyl)methanone (CAS 1246816-93-2) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 277.26 g/mol. IUPAC name: (3,4-dihydroxy-5-nitrophenyl)-(2,3,5,6-tetradeuterio-4-methylphenyl)methanone. InChIKey: MIQPIUSUKVNLNT-QFFDRWTDSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 277.26 g/mol |
| IUPAC name | (3,4-dihydroxy-5-nitrophenyl)-(2,3,5,6-tetradeuterio-4-methylphenyl)methanone |
| InChIKey | MIQPIUSUKVNLNT-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)[2H])[2H])C(=O)C2=CC(=C(C(=C2)O)O)[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)