CAS 1246817-04-8 is the registry number for Isoacetovanillone-d3. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1-[3-hydroxy-4-(trideuteriomethoxy)phenyl]ethanone (CAS 1246817-04-8) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 169.19 g/mol. IUPAC name: 1-[3-hydroxy-4-(trideuteriomethoxy)phenyl]ethanone. InChIKey: YLTGFGDODHXMFB-BMSJAHLVSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 169.19 g/mol |
| IUPAC name | 1-[3-hydroxy-4-(trideuteriomethoxy)phenyl]ethanone |
| InChIKey | YLTGFGDODHXMFB-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C(=O)C)O |
Computed by PubChem (NCBI)