CAS 1246817-05-9 is the registry number for 2-Ethyl-2-methyl-succinonitrile-d3. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
2-methyl-2-(2,2,2-trideuterioethyl)butanedinitrile (CAS 1246817-05-9) is a chemical compound with the molecular formula C7H10N2 and a molecular weight of 125.19 g/mol. IUPAC name: 2-methyl-2-(2,2,2-trideuterioethyl)butanedinitrile. InChIKey: DJZGLUQLFIHGPM-FIBGUPNXSA-N.
| Molecular formula | C7H10N2 |
|---|---|
| Molecular weight | 125.19 g/mol |
| IUPAC name | 2-methyl-2-(2,2,2-trideuterioethyl)butanedinitrile |
| InChIKey | DJZGLUQLFIHGPM-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(C)(CC#N)C#N |
Computed by PubChem (NCBI)