Products 1246817-05-9

CAS 1246817-05-9 is the registry number for 2-Ethyl-2-methyl-succinonitrile-d3. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.

Structural formula: {0} (CAS {1})

2-methyl-2-(2,2,2-trideuterioethyl)butanedinitrile (CAS 1246817-05-9) is a chemical compound with the molecular formula C7H10N2 and a molecular weight of 125.19 g/mol. IUPAC name: 2-methyl-2-(2,2,2-trideuterioethyl)butanedinitrile. InChIKey: DJZGLUQLFIHGPM-FIBGUPNXSA-N.

Identity
Molecular formulaC7H10N2
Molecular weight125.19 g/mol
IUPAC name2-methyl-2-(2,2,2-trideuterioethyl)butanedinitrile
InChIKeyDJZGLUQLFIHGPM-FIBGUPNXSA-N
SMILES[2H]C([2H])([2H])CC(C)(CC#N)C#N

Computed by PubChem (NCBI)