CAS 1246817-08-2 appears in our catalog under these names: Demethyl Benzydamine-d3 Hydrochloride, Demethyl Benzydamine-d3 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
3-(1-benzylindazol-3-yl)oxy-N-(trideuteriomethyl)propan-1-amine;hydrochloride (CAS 1246817-08-2) is a chemical compound with the molecular formula C18H22ClN3O and a molecular weight of 334.9 g/mol. IUPAC name: 3-(1-benzylindazol-3-yl)oxy-N-(trideuteriomethyl)propan-1-amine;hydrochloride. InChIKey: VCBUAEBLTYVPPB-NIIDSAIPSA-N.
| Molecular formula | C18H22ClN3O |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | 3-(1-benzylindazol-3-yl)oxy-N-(trideuteriomethyl)propan-1-amine;hydrochloride |
| InChIKey | VCBUAEBLTYVPPB-NIIDSAIPSA-N |
| SMILES | [2H]C([2H])([2H])NCCCOC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)