Products 1246817-13-9
CAS 1246817-13-9 appears in our catalog under these names: 4-Acetylbutyric Acid-d5 (Major), 4–Acetylbutyric Acid–d5, Glurate-d5. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 1g, 10mg, 1 g, 100 mg.
4,4,6,6,6-pentadeuterio-5-oxohexanoic acid (CAS 1246817-13-9) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 135.17 g/mol. IUPAC name: 4,4,6,6,6-pentadeuterio-5-oxohexanoic acid. InChIKey: MGTZCLMLSSAXLD-WNWXXORZSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 135.17 g/mol |
| IUPAC name | 4,4,6,6,6-pentadeuterio-5-oxohexanoic acid |
| InChIKey | MGTZCLMLSSAXLD-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C([2H])([2H])CCC(=O)O |
Computed by PubChem (NCBI)