CAS 1246817-17-3 is the registry number for 1,4-Diiodobenzene-13C6. Offered by: TRC. Available pack sizes: 250mg, 50mg, 5mg.
1,4-diiodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 1246817-17-3) is a chemical compound with the molecular formula C6H4I2 and a molecular weight of 335.861 g/mol. IUPAC name: 1,4-diiodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: LFMWZTSOMGDDJU-IDEBNGHGSA-N.
| Molecular formula | C6H4I2 |
|---|---|
| Molecular weight | 335.861 g/mol |
| IUPAC name | 1,4-diiodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | LFMWZTSOMGDDJU-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1I)I |
Computed by PubChem (NCBI)