CAS 1246817-39-9 is the registry number for O-Benzyl Psilocybin-d4. Offered by: TRC. Available pack sizes: 50mg.
Benzyl [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate (CAS 1246817-39-9) is a chemical compound with the molecular formula C19H23N2O4P and a molecular weight of 378.4 g/mol. IUPAC name: benzyl [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate. InChIKey: GKAIYZRUCXEQSP-AREBVXNXSA-N.
| Molecular formula | C19H23N2O4P |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | benzyl [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate |
| InChIKey | GKAIYZRUCXEQSP-AREBVXNXSA-N |
| SMILES | [2H]C([2H])(C1=CNC2=C1C(=CC=C2)OP(=O)(O)OCC3=CC=CC=C3)C([2H])([2H])N(C)C |
Computed by PubChem (NCBI)