Products 1246817-39-9

CAS 1246817-39-9 is the registry number for O-Benzyl Psilocybin-d4. Offered by: TRC. Available pack sizes: 50mg.

Structural formula: {0} (CAS {1})

Benzyl [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate (CAS 1246817-39-9) is a chemical compound with the molecular formula C19H23N2O4P and a molecular weight of 378.4 g/mol. IUPAC name: benzyl [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate. InChIKey: GKAIYZRUCXEQSP-AREBVXNXSA-N.

Identity
Molecular formulaC19H23N2O4P
Molecular weight378.4 g/mol
IUPAC namebenzyl [3-[1,1,2,2-tetradeuterio-2-(dimethylamino)ethyl]-1H-indol-4-yl] hydrogen phosphate
InChIKeyGKAIYZRUCXEQSP-AREBVXNXSA-N
SMILES[2H]C([2H])(C1=CNC2=C1C(=CC=C2)OP(=O)(O)OCC3=CC=CC=C3)C([2H])([2H])N(C)C

Computed by PubChem (NCBI)