CAS 1246817-41-3 is the registry number for N-(4-Bromobenzyl)-2-butyl-4-chloro-1H-imidazole-5-carboxylic Acid. Offered by: TRC. Available pack sizes: 250mg, 25mg.
3-[(4-bromophenyl)methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid (CAS 1246817-41-3) is a chemical compound with the molecular formula C15H16BrClN2O2 and a molecular weight of 371.65 g/mol. IUPAC name: 3-[(4-bromophenyl)methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid. InChIKey: PJDRSVWUSJGAHJ-UHFFFAOYSA-N.
| Molecular formula | C15H16BrClN2O2 |
|---|---|
| Molecular weight | 371.65 g/mol |
| IUPAC name | 3-[(4-bromophenyl)methyl]-2-butyl-5-chloroimidazole-4-carboxylic acid |
| InChIKey | PJDRSVWUSJGAHJ-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC(=C(N1CC2=CC=C(C=C2)Br)C(=O)O)Cl |
Computed by PubChem (NCBI)