Products 1246817-54-8

CAS 1246817-54-8 is the registry number for Isopentenyl Pyrophosphate-d5 Triammonium Salt. Offered by: TRC. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

[4,4-dideuterio-3-(trideuteriomethyl)but-3-enyl] phosphono hydrogen phosphate (CAS 1246817-54-8) is a chemical compound with the molecular formula C5H12O7P2 and a molecular weight of 251.12 g/mol. IUPAC name: [4,4-dideuterio-3-(trideuteriomethyl)but-3-enyl] phosphono hydrogen phosphate. InChIKey: NUHSROFQTUXZQQ-KPAILUHGSA-N.

Identity
Molecular formulaC5H12O7P2
Molecular weight251.12 g/mol
IUPAC name[4,4-dideuterio-3-(trideuteriomethyl)but-3-enyl] phosphono hydrogen phosphate
InChIKeyNUHSROFQTUXZQQ-KPAILUHGSA-N
SMILES[2H]C(=C(CCOP(=O)(O)OP(=O)(O)O)C([2H])([2H])[2H])[2H]

Computed by PubChem (NCBI)