CAS 1246817-59-3 is the registry number for 1-(tert-Butyldimethylsilyloxy)-1-ethynyl-cyclopropane-d4. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
Tert-butyl-dimethyl-(2,2,3,3-tetradeuterio-1-ethynylcyclopropyl)oxysilane (CAS 1246817-59-3) is a chemical compound with the molecular formula C11H20OSi and a molecular weight of 200.39 g/mol. IUPAC name: tert-butyl-dimethyl-(2,2,3,3-tetradeuterio-1-ethynylcyclopropyl)oxysilane. InChIKey: QUZAQDCZJSFOGQ-LZMSFWOYSA-N.
| Molecular formula | C11H20OSi |
|---|---|
| Molecular weight | 200.39 g/mol |
| IUPAC name | tert-butyl-dimethyl-(2,2,3,3-tetradeuterio-1-ethynylcyclopropyl)oxysilane |
| InChIKey | QUZAQDCZJSFOGQ-LZMSFWOYSA-N |
| SMILES | [2H]C1(C(C1(C#C)O[Si](C)(C)C(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)