Products 1246818-16-5
CAS 1246818-16-5 appears in our catalog under these names: Pyridoxal-d5 5'-phosphate, Pyridoxal-d5 5'-Phosphate, >95% (HPLC), Pyridoxal phosphate–d5, Pyridoxal phosphate-d5, 99.30%. Offered by: Biosynth, TRC, GLPBio, MedChemExpress. Available pack sizes: 1mg, 0,5mg, 2mg, 5mg, 500μg, 500 μg.
[dideuterio-[4-formyl-5-hydroxy-6-(trideuteriomethyl)-3-pyridinyl]methyl] dihydrogen phosphate (CAS 1246818-16-5) is a chemical compound with the molecular formula C8H10NO6P and a molecular weight of 252.17 g/mol. IUPAC name: [dideuterio-[4-formyl-5-hydroxy-6-(trideuteriomethyl)-3-pyridinyl]methyl] dihydrogen phosphate. InChIKey: NGVDGCNFYWLIFO-SGEUAGPISA-N.
| Molecular formula | C8H10NO6P |
|---|---|
| Molecular weight | 252.17 g/mol |
| IUPAC name | [dideuterio-[4-formyl-5-hydroxy-6-(trideuteriomethyl)-3-pyridinyl]methyl] dihydrogen phosphate |
| InChIKey | NGVDGCNFYWLIFO-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C1=NC=C(C(=C1O)C=O)C([2H])([2H])OP(=O)(O)O |
Computed by PubChem (NCBI)