Products 1246818-63-2
CAS 1246818-63-2 appears in our catalog under these names: Benzyl Isothiocyanate-d7, >95% (HPLC), Benzyl isothiocyanate-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
1,2,3,4,5-pentadeuterio-6-[dideuterio(isothiocyanato)methyl]benzene (CAS 1246818-63-2) is a chemical compound with the molecular formula C8H7NS and a molecular weight of 156.26 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-[dideuterio(isothiocyanato)methyl]benzene. InChIKey: MDKCFLQDBWCQCV-XZJKGWKKSA-N.
| Molecular formula | C8H7NS |
|---|---|
| Molecular weight | 156.26 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-[dideuterio(isothiocyanato)methyl]benzene |
| InChIKey | MDKCFLQDBWCQCV-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])N=C=S)[2H])[2H] |
Computed by PubChem (NCBI)