CAS 1246818-69-8 is the registry number for iso-Colchicine-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 10mg, 25mg, 100mg, 50 mg, 5 mg.
2,2,2-trideuterio-N-[(7S)-1,2,3,9-tetramethoxy-10-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (CAS 1246818-69-8) is a chemical compound with the molecular formula C22H25NO6 and a molecular weight of 402.5 g/mol. IUPAC name: 2,2,2-trideuterio-N-[(7S)-1,2,3,9-tetramethoxy-10-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide. InChIKey: MDYALASTPGGXQH-AVSFSGARSA-N.
| Molecular formula | C22H25NO6 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[(7S)-1,2,3,9-tetramethoxy-10-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| InChIKey | MDYALASTPGGXQH-AVSFSGARSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=C1C=C(C(=O)C=C3)OC)OC)OC)OC |
Computed by PubChem (NCBI)