CAS 1246819-30-6 appears in our catalog under these names: Isohexanol-d7, 4-Methyl-1-pentanol-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 100 mg, 10 mg, 25 mg.
4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentan-1-ol (CAS 1246819-30-6) is a chemical compound with the molecular formula C6H14O and a molecular weight of 109.22 g/mol. IUPAC name: 4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentan-1-ol. InChIKey: PCWGTDULNUVNBN-NWOXSKRJSA-N.
| Molecular formula | C6H14O |
|---|---|
| Molecular weight | 109.22 g/mol |
| IUPAC name | 4,5,5,5-tetradeuterio-4-(trideuteriomethyl)pentan-1-ol |
| InChIKey | PCWGTDULNUVNBN-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CCCO)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)