Products 1246819-32-8
CAS 1246819-32-8 appears in our catalog under these names: Mefloquine Impurity 1-d5, Dehydro Mefloquine-d5, >95% (HPLC), Dehydro Mefloquine-d5. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg.
[2,8-bis(trifluoromethyl)quinolin-4-yl]-deuterio-(3,4,5,6-tetradeuterio-2-pyridinyl)methanol (CAS 1246819-32-8) is a chemical compound with the molecular formula C17H10F6N2O and a molecular weight of 377.29 g/mol. IUPAC name: [2,8-bis(trifluoromethyl)quinolin-4-yl]-deuterio-(3,4,5,6-tetradeuterio-2-pyridinyl)methanol. InChIKey: LUDFDSXDVJABBT-PPCDZPRBSA-N.
| Molecular formula | C17H10F6N2O |
|---|---|
| Molecular weight | 377.29 g/mol |
| IUPAC name | [2,8-bis(trifluoromethyl)quinolin-4-yl]-deuterio-(3,4,5,6-tetradeuterio-2-pyridinyl)methanol |
| InChIKey | LUDFDSXDVJABBT-PPCDZPRBSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C([2H])(C2=CC(=NC3=C2C=CC=C3C(F)(F)F)C(F)(F)F)O)[2H])[2H] |
Computed by PubChem (NCBI)