CAS 1246819-69-1 appears in our catalog under these names: BD 1063-d8 Dihydrochloride, BD1063-d8 (dihydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
2,2,3,3,5,5,6,6-octadeuterio-1-[2-(3,4-dichlorophenyl)ethyl]-4-methylpiperazine (CAS 1246819-69-1) is a chemical compound with the molecular formula C13H18Cl2N2 and a molecular weight of 281.25 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-[2-(3,4-dichlorophenyl)ethyl]-4-methylpiperazine. InChIKey: SUIZRDJCBVPASY-COMRDEPKSA-N.
| Molecular formula | C13H18Cl2N2 |
|---|---|
| Molecular weight | 281.25 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-[2-(3,4-dichlorophenyl)ethyl]-4-methylpiperazine |
| InChIKey | SUIZRDJCBVPASY-COMRDEPKSA-N |
| SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])CCC2=CC(=C(C=C2)Cl)Cl)([2H])[2H])[2H] |
Computed by PubChem (NCBI)