Products 1246819-70-4
CAS 1246819-70-4 is the registry number for 1-Methyl-5-amino-1H-benzimidazole-2-butanoic Acid Ethyl Ester-d3. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Ethyl 4-[5-amino-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate (CAS 1246819-70-4) is a chemical compound with the molecular formula C14H19N3O2 and a molecular weight of 264.34 g/mol. IUPAC name: ethyl 4-[5-amino-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate. InChIKey: JUMGOLYNZBZPKE-BMSJAHLVSA-N.
| Molecular formula | C14H19N3O2 |
|---|---|
| Molecular weight | 264.34 g/mol |
| IUPAC name | ethyl 4-[5-amino-1-(trideuteriomethyl)benzimidazol-2-yl]butanoate |
| InChIKey | JUMGOLYNZBZPKE-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C2=C(C=C(C=C2)N)N=C1CCCC(=O)OCC |
Computed by PubChem (NCBI)