Products 1246819-88-4
CAS 1246819-88-4 appears in our catalog under these names: 2–(2–Aminoethylamino)ethanol–d4, 2-(2-Aminoethylamino)ethanol-d4. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 1 mg.
2-(2-aminoethylamino)-1,1,2,2-tetradeuterioethanol (CAS 1246819-88-4) is a chemical compound with the molecular formula C4H12N2O and a molecular weight of 108.18 g/mol. IUPAC name: 2-(2-aminoethylamino)-1,1,2,2-tetradeuterioethanol. InChIKey: LHIJANUOQQMGNT-KHORGVISSA-N.
| Molecular formula | C4H12N2O |
|---|---|
| Molecular weight | 108.18 g/mol |
| IUPAC name | 2-(2-aminoethylamino)-1,1,2,2-tetradeuterioethanol |
| InChIKey | LHIJANUOQQMGNT-KHORGVISSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NCCN |
Computed by PubChem (NCBI)