Products 1246819-89-5
CAS 1246819-89-5 appears in our catalog under these names: rac 2-Ethenyl-4,6-dimethoxy-benzoic Acid 1-Methyl-5-oxo-9-decen-1-yl Ester-d6, Methoxycarbonyl Cefadroxil-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg, 25 mg.
(1,1,1,2,3,3-hexadeuterio-6-oxoundec-10-en-2-yl) 2-ethenyl-4,6-dimethoxybenzoate (CAS 1246819-89-5) is a chemical compound with the molecular formula C22H30O5 and a molecular weight of 380.5 g/mol. IUPAC name: (1,1,1,2,3,3-hexadeuterio-6-oxoundec-10-en-2-yl) 2-ethenyl-4,6-dimethoxybenzoate. InChIKey: QWDNEGNCWJHTQE-KYLWONQVSA-N.
| Molecular formula | C22H30O5 |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | (1,1,1,2,3,3-hexadeuterio-6-oxoundec-10-en-2-yl) 2-ethenyl-4,6-dimethoxybenzoate |
| InChIKey | QWDNEGNCWJHTQE-KYLWONQVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])CCC(=O)CCCC=C)OC(=O)C1=C(C=C(C=C1OC)OC)C=C |
Computed by PubChem (NCBI)